| Product Name | 2,3-Dihydroxy-6-chloroquinoxaline |
| CAS No. | 6639-79-8 |
| InChI | InChI=1/C8H5ClN2O2/c9-4-1-2-5-6(3-4)11-8(13)7(12)10-5/h1-3H,(H,10,12)(H,11,13) |
| Molecular Formula | C8H5ClN2O2 |
| Molecular Weight | 196.59 |
| Melting point | 250℃ |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
6639-79-8 2,3-dihydroxy-6-chloroquinoxaline
service@apichina.com