| Product Name | 2,3-Dihydro-1H-benz[de]isoquinoline |
| CAS No. | 22817-26-1 |
| Synonyms | 2,3-dihydro-1H-benzo[de]isoquinoline |
| InChI | InChI=1/C12H11N/c1-3-9-4-2-6-11-8-13-7-10(5-1)12(9)11/h1-6,13H,7-8H2 |
| Molecular Formula | C12H11N |
| Molecular Weight | 169.2224 |
| Density | 1.138g/cm3 |
| Boiling point | 334.8°C at 760 mmHg |
| Flash point | 171.2°C |
| Refractive index | 1.661 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
22817-26-1 2,3-dihydro-1h-benz[de]isoquinoline
service@apichina.com