| Product Name | 2,3-dihydro-1-benzofuran-2-carbonyl chloride |
| CAS No. | 27347-32-6 |
| InChI | InChI=1/C9H7ClO2/c10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-4,8H,5H2 |
| Molecular Formula | C9H7ClO2 |
| Molecular Weight | 182.6037 |
| Density | 1.345g/cm3 |
| Boiling point | 270.5°C at 760 mmHg |
| Flash point | 100.8°C |
| Refractive index | 1.575 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
27347-32-6 2,3-dihydro-1-benzofuran-2-carbonyl chloride
service@apichina.com