| Product Name | 2,3-Dihydro-1,4-benzodioxine-5-carbonyl chloride |
| CAS No. | 38871-41-9 |
| InChI | InChI=1/C9H7ClO3/c10-9(11)6-2-1-3-7-8(6)13-5-4-12-7/h1-3H,4-5H2 |
| Molecular Formula | C9H7ClO3 |
| Molecular Weight | 198.6031 |
| Density | 1.371g/cm3 |
| Melting point | 77.3℃ |
| Boiling point | 305.2°C at 760 mmHg |
| Flash point | 137.7°C |
| Refractive index | 1.566 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
38871-41-9 2,3-dihydro-1,4-benzodioxine-5-carbonyl chloride
service@apichina.com