| Product Name | 2,3-Dihydro-1,4-benzodioxin-5-ylmethylamine |
| CAS No. | 261633-71-0 |
| Synonyms | 1-(2,3-dihydro-1,4-benzodioxin-5-yl)methanamine hydrochloride |
| InChI | InChI=1/C9H11NO2.ClH/c10-6-7-2-1-3-8-9(7)12-5-4-11-8;/h1-3H,4-6,10H2;1H |
| Molecular Formula | C9H12ClNO2 |
| Molecular Weight | 201.6501 |
| Boiling point | 287.5°C at 760 mmHg |
| Flash point | 138.8°C |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
261633-71-0 2,3-dihydro-1,4-benzodioxin-5-ylmethylamine
service@apichina.com