| Product Name | 2,3-difluorophenylacetonitrile |
| CAS No. | 145689-34-5 |
| Synonyms | 2,3-Difluorobenzylcyanide; 2,3-difluorophenylacetanitrile |
| InChI | InChI=1/C8H5F2N/c9-7-3-1-2-6(4-5-11)8(7)10/h1-3H,4H2 |
| Molecular Formula | C8H5F2N |
| Molecular Weight | 153.1288 |
| Density | 1.234g/cm3 |
| Boiling point | 216.9°C at 760 mmHg |
| Flash point | 85°C |
| Refractive index | 1.487 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S36/37:Wear suitable protective clothing and gloves.; |
145689-34-5 2,3-difluorophenylacetonitrile
service@apichina.com