| Product Name | 2,3-difluorobenzophenone |
| CAS No. | 208173-20-0 |
| Synonyms | (2,3-difluorophenyl)(phenyl)methanone |
| InChI | InChI=1/C13H8F2O/c14-11-8-4-7-10(12(11)15)13(16)9-5-2-1-3-6-9/h1-8H |
| Molecular Formula | C13H8F2O |
| Molecular Weight | 218.1988 |
| Density | 1.239g/cm3 |
| Boiling point | 331.2°C at 760 mmHg |
| Flash point | 127°C |
| Refractive index | 1.549 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
208173-20-0 2,3-difluorobenzophenone
service@apichina.com