| Product Name | 2,3-difluorobenzamide |
| CAS No. | 18355-75-4 |
| Synonyms | 2,3-Difluorobenzamide |
| InChI | InChI=1/C7H5F2NO/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,(H2,10,11) |
| Molecular Formula | C7H5F2NO |
| Molecular Weight | 157.1175 |
| Density | 1.348g/cm3 |
| Boiling point | 197°C at 760 mmHg |
| Flash point | 73°C |
| Refractive index | 1.515 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
18355-75-4 2,3-difluorobenzamide
service@apichina.com