| Product Name | 2,3-difluoroacetophenone |
| CAS No. | 18355-80-1 |
| Synonyms | 2',3'-difluoroacetophenone; 1-(2,3-difluorophenyl)ethanone |
| InChI | InChI=1/C8H6F2O/c1-5(11)6-3-2-4-7(9)8(6)10/h2-4H,1H3 |
| Molecular Formula | C8H6F2O |
| Molecular Weight | 156.1294 |
| Density | 1.206g/cm3 |
| Boiling point | 193.4°C at 760 mmHg |
| Flash point | 71.5°C |
| Refractive index | 1.472 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
18355-80-1 2,3-difluoroacetophenone
service@apichina.com