| Product Name | 2,3-Difluoro-4-methylbenzoyl chloride |
| CAS No. | 261763-38-6 |
| Synonyms | 2,3-Difluoro-p-toluoyl chloride |
| InChI | InChI=1/C8H5ClF2O/c1-4-2-3-5(8(9)12)7(11)6(4)10/h2-3H,1H3 |
| Molecular Formula | C8H5ClF2O |
| Molecular Weight | 190.5745 |
| Density | 1.356g/cm3 |
| Boiling point | 221.2°C at 760 mmHg |
| Flash point | 87.6°C |
| Refractive index | 1.499 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
261763-38-6 2,3-difluoro-4-methylbenzoyl chloride
service@apichina.com