| Product Name | 2,3-Difluoro-4-methylbenzoic acid |
| CAS No. | 261763-37-5 |
| Synonyms | 2,3-Difluoro-p-toluic acid |
| InChI | InChI=1/C8H6F2O2/c1-4-2-3-5(8(11)12)7(10)6(4)9/h2-3H,1H3,(H,11,12) |
| Molecular Formula | C8H6F2O2 |
| Molecular Weight | 172.1288 |
| Density | 1.359g/cm3 |
| Boiling point | 274°C at 760 mmHg |
| Flash point | 119.5°C |
| Refractive index | 1.511 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
261763-37-5 2,3-difluoro-4-methylbenzoic acid
service@apichina.com