| Product Name | 2,3-Difluoro-4-methylbenzaldehyde |
| CAS No. | 245536-50-9 |
| Synonyms | 2,3-Difluoro-p-tolualdehyde |
| InChI | InChI=1/C8H6F2O/c1-5-2-3-6(4-11)8(10)7(5)9/h2-4H,1H3 |
| Molecular Formula | C8H6F2O |
| Molecular Weight | 156.1294 |
| Density | 1.241g/cm3 |
| Boiling point | 204.2°C at 760 mmHg |
| Flash point | 76.1°C |
| Refractive index | 1.513 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
245536-50-9 2,3-difluoro-4-methylbenzaldehyde
service@apichina.com