| Product Name | 2,3-Dichlorothiophene |
| CAS No. | 17249-79-5;17249-29-5 |
| Synonyms | 2,3-dichloro-thiophene |
| InChI | InChI=1/C4H2Cl2S/c5-3-1-2-7-4(3)6/h1-2H |
| Molecular Formula | C4H2Cl2S |
| Molecular Weight | 153.0297 |
| Density | 1.488g/cm3 |
| Melting point | -26℃ |
| Boiling point | 170.7°C at 760 mmHg |
| Flash point | 68.9°C |
| Refractive index | 1.584 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S36/37:Wear suitable protective clothing and gloves.; |
17249-79-5;17249-29-5 2,3-dichlorothiophene
service@apichina.com