| Product Name | 2,3-Dichlorobutane |
| CAS No. | 7581-97-7 |
| Synonyms | 2,3-Dichlorobutane,mixture of dl and meso; 2,3-Dichlorobutane- dl + meso; (2S,3S)-2,3-dichlorobutane |
| InChI | InChI=1/C4H8Cl2/c1-3(5)4(2)6/h3-4H,1-2H3/t3-,4-/m0/s1 |
| Molecular Formula | C4H8Cl2 |
| Molecular Weight | 127.0123 |
| Density | 1.076g/cm3 |
| Melting point | -80℃ |
| Boiling point | 110.467°C at 760 mmHg |
| Flash point | 18.333°C |
| Refractive index | 1.425 |
| Hazard Symbols |  F:Highly flammable; |
| Risk Codes | R11:Highly flammable.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; |
7581-97-7 2,3-dichlorobutane
service@apichina.com