| Product Name | 2,3-dichlorobenzyl bromide |
| CAS No. | 57915-78-3 |
| Synonyms | 1-(bromomethyl)-2,3-dichlorobenzene |
| InChI | InChI=1/C7H5BrCl2/c8-4-5-2-1-3-6(9)7(5)10/h1-3H,4H2 |
| Molecular Formula | C7H5BrCl2 |
| Molecular Weight | 239.9246 |
| Density | 1.679g/cm3 |
| Melting point | 38℃ |
| Boiling point | 263.3°C at 760 mmHg |
| Flash point | 127.3°C |
| Refractive index | 1.597 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S25:Avoid contact with eyes.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
57915-78-3 2,3-dichlorobenzyl bromide
service@apichina.com