| Product Name | 2,3-Dichloroacetophenone |
| CAS No. | 56041-57-7 |
| Synonyms | 1-(2,3-Dichlorophenyl)ethan-1-one; 1-(2,3-dichlorophenyl)ethanone |
| InChI | InChI=1/C8H6Cl2O/c1-5(11)6-3-2-4-7(9)8(6)10/h2-4H,1H3 |
| Molecular Formula | C8H6Cl2O |
| Molecular Weight | 189.0386 |
| Density | 1.304g/cm3 |
| Melting point | 106℃ |
| Boiling point | 247.3°C at 760 mmHg |
| Flash point | 101.3°C |
| Refractive index | 1.548 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
56041-57-7 2,3-dichloroacetophenone
service@apichina.com