| Product Name | 2,3-Dibromosuccinic acid |
| CAS No. | 526-78-3;608-35-5;608-36-6 |
| Synonyms | Dibromosuccinicacid; 2,3-Dibromosucinic Acid; 2,3-Dibromo Dibutyric Acid; meso-2,3-Dibromosuccinic acid; (2R,3S)-2,3-dibromobutanedioic acid; (2R,3S)-2,3-dibromobutanedioate |
| InChI | InChI=1/C4H4Br2O4/c5-1(3(7)8)2(6)4(9)10/h1-2H,(H,7,8)(H,9,10)/p-2/t1-,2+ |
| Molecular Formula | C4H2Br2O4 |
| Molecular Weight | 273.8654 |
| Melting point | 255-260℃ |
| Boiling point | 262.4°C at 760 mmHg |
| Flash point | 112.5°C |
| Water solubility | 20 g/L (17℃) |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
526-78-3;608-35-5;608-36-6 2,3-dibromosuccinic acid
service@apichina.com