| Product Name | 2,3-Dibromofuran |
| CAS No. | 30544-34-4 |
| InChI | InChI=1/C4H2Br2O/c5-3-1-2-7-4(3)6/h1-2H |
| Molecular Formula | C4H2Br2O |
| Molecular Weight | 225.8661 |
| Density | 2.159g/cm3 |
| Boiling point | 175.6°C at 760 mmHg |
| Flash point | 60°C |
| Refractive index | 1.562 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
30544-34-4 2,3-dibromofuran
service@apichina.com