| Product Name | 2,3-Diaminonaphthalene |
| CAS No. | 771-97-1 |
| Synonyms | 2,3-Naphthalenediamine; naphthalene-2,3-diamine |
| InChI | InChI=1/C10H10N2/c11-9-5-7-3-1-2-4-8(7)6-10(9)12/h1-6H,11-12H2 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.1998 |
| Density | 1.234g/cm3 |
| Melting point | 193-199℃ |
| Boiling point | 370.6°C at 760 mmHg |
| Flash point | 212.3°C |
| Refractive index | 1.757 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
771-97-1 2,3-diaminonaphthalene
service@apichina.com