| Product Name | 2,3-cycloheptenopyridine |
| CAS No. | 7197-96-8 |
| InChI | InChI=1/C10H13N/c1-2-5-9-6-4-8-11-10(9)7-3-1/h4,6,8H,1-3,5,7H2 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.2169 |
| Density | 0.999g/cm3 |
| Boiling point | 224.9°C at 760 mmHg |
| Flash point | 93.3°C |
| Refractive index | 1.533 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
7197-96-8 2,3-cycloheptenopyridine
service@apichina.com