| Product Name | 2-(3-chlorophenoxy)acetamide |
| CAS No. | 35368-69-5 |
| InChI | InChI=1/C8H8ClNO2/c9-6-2-1-3-7(4-6)12-5-8(10)11/h1-4H,5H2,(H2,10,11) |
| Molecular Formula | C8H8ClNO2 |
| Molecular Weight | 185.6076 |
| Density | 1.3g/cm3 |
| Melting point | 123℃ |
| Boiling point | 374.2°C at 760 mmHg |
| Flash point | 180.1°C |
| Refractive index | 1.558 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
35368-69-5 2-(3-chlorophenoxy)acetamide
service@apichina.com