| Product Name | 2-[(3-chloro-2-pyrazinyl)amino]-1-ethanol |
| CAS No. | 84066-20-6 |
| Synonyms | 2-[(3-chloropyrazin-2-yl)amino]ethanol |
| InChI | InChI=1/C6H8ClN3O/c7-5-6(10-3-4-11)9-2-1-8-5/h1-2,11H,3-4H2,(H,9,10) |
| Molecular Formula | C6H8ClN3O |
| Molecular Weight | 173.6002 |
| Density | 1.431g/cm3 |
| Melting point | 54℃ |
| Boiling point | 340.4°C at 760 mmHg |
| Flash point | 159.7°C |
| Refractive index | 1.629 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
84066-20-6 2-[(3-chloro-2-pyrazinyl)amino]-1-ethanol
service@apichina.com