| Product Name | 2-(3-Bromo-4-methoxyphenyl)ethylamine |
| CAS No. | 159465-27-7 |
| Synonyms | 3-Bromo-4-methoxyphenethylamine; 2-(3-bromo-4-methoxyphenyl)ethanamine |
| InChI | InChI=1/C9H12BrNO/c1-12-9-3-2-7(4-5-11)6-8(9)10/h2-3,6H,4-5,11H2,1H3 |
| Molecular Formula | C9H12BrNO |
| Molecular Weight | 230.1017 |
| Density | 1.385g/cm3 |
| Boiling point | 303.6°C at 760 mmHg |
| Flash point | 137.4°C |
| Refractive index | 1.559 |
| Risk Codes | R34:Causes burns.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
159465-27-7 2-(3-bromo-4-methoxyphenyl)ethylamine
service@apichina.com