| Product Name | 2,3-Benzanthracene |
| CAS No. | 92-24-0 |
| Synonyms | NAPHTHACENE; Chrysogen; LT-S940; Tetracene |
| InChI | InChI=1/C18H12/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1/h1-12H |
| Molecular Formula | C18H12 |
| Molecular Weight | 228.2879 |
| Density | 1.19g/cm3 |
| Melting point | 300℃ |
| Boiling point | 436.7°C at 760 mmHg |
| Flash point | 209.1°C |
| Refractive index | 1.771 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R40:Possible risks of irreversible effects.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
92-24-0 2,3-benzanthracene
service@apichina.com