| Product Name | 2,3,6-trifluorobenzyl alcohol |
| CAS No. | 114152-19-1 |
| InChI | InChI=1/C7H5F3O/c8-5-1-2-6(9)7(10)4(5)3-11/h1-2,11H,3H2 |
| Molecular Formula | C7H5F3O |
| Molecular Weight | 162.1092 |
| Density | 1.398g/cm3 |
| Melting point | 43-45℃ |
| Boiling point | 187°C at 760 mmHg |
| Flash point | 80.8°C |
| Refractive index | 1.476 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
114152-19-1 2,3,6-trifluorobenzyl alcohol
service@apichina.com