| Product Name | 2,3,6-trifluoroacetophenone |
| CAS No. | 208173-22-2 |
| Synonyms | 2',3',6'-trifluoroacetophenone; 1-(2,3,6-trifluorophenyl)ethanone |
| InChI | InChI=1/C8H5F3O/c1-4(12)7-5(9)2-3-6(10)8(7)11/h2-3H,1H3 |
| Molecular Formula | C8H5F3O |
| Molecular Weight | 174.1199 |
| Density | 1.303g/cm3 |
| Boiling point | 187.2°C at 760 mmHg |
| Flash point | 65°C |
| Refractive index | 1.455 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
208173-22-2 2,3,6-trifluoroacetophenone
service@apichina.com