| Product Name | 2,3,6-Trichlorophenylacetonitrile |
| CAS No. | 3215-65-4 |
| Synonyms | 2,3,6-Trichlorobenzyl cyanide |
| InChI | InChI=1/C8H4Cl3N/c9-6-1-2-7(10)8(11)5(6)3-4-12/h1-2H,3H2 |
| Molecular Formula | C8H4Cl3N |
| Molecular Weight | 220.4831 |
| Density | 1.455g/cm3 |
| Boiling point | 316.9°C at 760 mmHg |
| Flash point | 138.2°C |
| Refractive index | 1.579 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
3215-65-4 2,3,6-trichlorophenylacetonitrile
service@apichina.com