| Product Name | 2,3,5-Trichlorothiophene |
| CAS No. | 17249-77-3 |
| Synonyms | Thiophene, 2,3,5-trichloro-; AI3-16301 |
| InChI | InChI=1/C4HCl3S/c5-2-1-3(6)8-4(2)7/h1H |
| Molecular Formula | C4HCl3S |
| Molecular Weight | 187.4747 |
| Density | 1.633g/cm3 |
| Boiling point | 200.5°C at 760 mmHg |
| Flash point | 95.6°C |
| Refractive index | 1.601 |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
17249-77-3 2,3,5-trichlorothiophene
service@apichina.com