| Product Name | 2,3,5-Trichlorophenol |
| CAS No. | 933-78-8 |
| InChI | InChI=1/C6H3Cl3O/c7-3-1-4(8)6(9)5(10)2-3/h1-2,10H |
| Molecular Formula | C6H3Cl3O |
| Molecular Weight | 197.4464 |
| Density | 1.596g/cm3 |
| Melting point | 57-60℃ |
| Boiling point | 250.2°C at 760 mmHg |
| Flash point | 105.1°C |
| Refractive index | 1.608 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R22:Harmful if swallowed.; R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
933-78-8 2,3,5-trichlorophenol
service@apichina.com