| Product Name | 2,3,5-Trichlorobenzeneboronic acid |
| CAS No. | 212779-19-6 |
| Synonyms | Thiocarbamoylhydrazine; (2,3,5-trichlorophenyl)boronic acid; Boronic acid,B-(2,3,5-trichlorophenyl)-; 2,3,5-Trichlorophenylboronic acid |
| InChI | InChI=1/C6H4BCl3O2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2,11-12H |
| Molecular Formula | C6H4BCl3O2 |
| Molecular Weight | 225.2648 |
| Density | 1.6g/cm3 |
| Boiling point | 383.4°C at 760 mmHg |
| Flash point | 185.7°C |
| Refractive index | 1.594 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
212779-19-6 2,3,5-trichlorobenzeneboronic acid
service@apichina.com