| Product Name | 2-(3,5-dimethyl-1H-pyrazol-4-yl)benzoic acid |
| CAS No. | 321309-43-7 |
| InChI | InChI=1/C12H12N2O2/c1-7-11(8(2)14-13-7)9-5-3-4-6-10(9)12(15)16/h3-6H,1-2H3,(H,13,14)(H,15,16) |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.2359 |
| Density | 1.262g/cm3 |
| Melting point | 253.1℃ |
| Boiling point | 391.2°C at 760 mmHg |
| Flash point | 190.4°C |
| Refractive index | 1.616 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
321309-43-7 2-(3,5-dimethyl-1h-pyrazol-4-yl)benzoic acid
service@apichina.com