| Product Name | 2-(3,5-difluorophenyl)ethanoyl chloride |
| CAS No. | 157033-24-4 |
| Synonyms | (3,5-difluorophenyl)acetyl chloride |
| InChI | InChI=1/C8H5ClF2O/c9-8(12)3-5-1-6(10)4-7(11)2-5/h1-2,4H,3H2 |
| Molecular Formula | C8H5ClF2O |
| Molecular Weight | 190.5745 |
| Density | 1.369g/cm3 |
| Boiling point | 208.5°C at 760 mmHg |
| Flash point | 79.9°C |
| Refractive index | 1.496 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
157033-24-4 2-(3,5-difluorophenyl)ethanoyl chloride
service@apichina.com