| Product Name | 2,3,5,6-Tetramethyl-p-phenylenediamine |
| CAS No. | 3102-87-2 |
| Synonyms | 3,6-Diaminodurene; 2,3,5,6-tetramethylbenzene-1,4-diamine; 2,3,5,6-tetramethyl-1,4-phenylenediamine |
| InChI | InChI=1/C10H16N2/c1-5-6(2)10(12)8(4)7(3)9(5)11/h11-12H2,1-4H3 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.2474 |
| Density | 1.032g/cm3 |
| Melting point | 150-153℃ |
| Boiling point | 310.6°C at 760 mmHg |
| Flash point | 167.8°C |
| Refractive index | 1.594 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
3102-87-2 2,3,5,6-tetramethyl-p-phenylenediamine
service@apichina.com