| Product Name | 2,3,5,6-Tetrachlorothioanisole |
| CAS No. | 68671-90-9 |
| Synonyms | 1,2,4,5-Tetrachloro-3-(methylthio)benzene; Benzene, 1,2,4,5-tetrachloro-3-(methylthio)-; 1,2,4,5-tetrachloro-3-(methylsulfanyl)benzene |
| InChI | InChI=1/C7H4Cl4S/c1-12-7-5(10)3(8)2-4(9)6(7)11/h2H,1H3 |
| Molecular Formula | C7H4Cl4S |
| Molecular Weight | 261.9837 |
| Density | 1.58g/cm3 |
| Boiling point | 286°C at 760 mmHg |
| Flash point | 122.8°C |
| Refractive index | 1.629 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
68671-90-9 2,3,5,6-tetrachlorothioanisole
service@apichina.com