| Product Name | 2,3,5,6-Tetrachloronitrobenzene |
| CAS No. | 117-18-0 |
| Synonyms | 1,2,4,5-Tetrachloro-3-nitrobenzene; tecnazene; 3-Nitro-1,2,4,5-tetrachlorobenzene; Tecnazene; 1,2,3,4,5-pentachloro-6-nitrobenzene; 1,2,3,4-Tetrachloro-3-Nitrobenzene; Fumite(R); Fusarex(R); LABOTEST-BB LT00152717 |
| InChI | InChI=1/C6HCl4NO2/c7-2-1-3(8)5(10)6(4(2)9)11(12)13/h1H |
| Molecular Formula | C6HCl4NO2 |
| Molecular Weight | 260.8896 |
| Density | 1.75g/cm3 |
| Melting point | 98-101℃ |
| Boiling point | 304°C at 760 mmHg |
| Flash point | 143.1°C |
| Refractive index | 1.62 |
| Hazard Symbols |  Xn:Harmful;  N:Dangerous for the environment; |
| Risk Codes | R22:Harmful if swallowed.; R43:May cause sensitization by skin contact.; R50/53:Very toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.; |
| Safety | S24:Avoid contact with skin.; S37:Wear suitable gloves.; S60:This material and its container must be disposed of as hazardous waste.; S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.; |
117-18-0 2,3,5,6-tetrachloronitrobenzene
service@apichina.com