| Product Name | 2,3,5,6-tetrachloroisonicotinonitrile |
| CAS No. | 16297-06-6 |
| Synonyms | 2,3,5,6-tetrachloropyridine-4-carbonitrile |
| InChI | InChI=1/C6Cl4N2/c7-3-2(1-11)4(8)6(10)12-5(3)9 |
| Molecular Formula | C6Cl4N2 |
| Molecular Weight | 241.8896 |
| Density | 1.75g/cm3 |
| Melting point | 139℃ |
| Boiling point | 298.3°C at 760 mmHg |
| Flash point | 134.2°C |
| Refractive index | 1.62 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
16297-06-6 2,3,5,6-tetrachloroisonicotinonitrile
service@apichina.com