| Product Name | 2,3,5,6-Tetrachloroaniline |
| CAS No. | 3481-20-7 |
| Synonyms | NSC 29028; Aniline, 2,3,5,6-tetrachloro- (8CI); Benzenamine, 2,3,5,6-tetrachloro- (9CI) |
| InChI | InChI=1/C6H3Cl4N/c7-2-1-3(8)5(10)6(11)4(2)9/h1H,11H2 |
| Molecular Formula | C6H3Cl4N |
| Molecular Weight | 230.9067 |
| Density | 1.655g/cm3 |
| Boiling point | 299.1°C at 760 mmHg |
| Flash point | 134.7°C |
| Refractive index | 1.636 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R33:Danger of cummulative effects.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
3481-20-7 2,3,5,6-tetrachloroaniline
service@apichina.com