| Product Name | 2,3,4-Trimethoxybenzonitrile |
| CAS No. | 43020-38-8 |
| InChI | InChI=1/C10H11NO3/c1-12-8-5-4-7(6-11)9(13-2)10(8)14-3/h4-5H,1-3H3 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.1992 |
| Density | 1.15g/cm3 |
| Melting point | 55-57℃ |
| Boiling point | 311.1°C at 760 mmHg |
| Flash point | 127.8°C |
| Refractive index | 1.514 |
| Hazard Symbols |  T:Toxic; |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; |
| Safety | S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
43020-38-8 2,3,4-trimethoxybenzonitrile
service@apichina.com