| Product Name | 2,3,4-trifluorobenzoyl chloride |
| CAS No. | 157373-08-5 |
| InChI | InChI=1/C7H2ClF3O/c8-7(12)3-1-2-4(9)6(11)5(3)10/h1-2H |
| Molecular Formula | C7H2ClF3O |
| Molecular Weight | 194.5384 |
| Density | 1.514g/cm3 |
| Boiling point | 203.2°C at 760 mmHg |
| Flash point | 60.4°C |
| Refractive index | 1.479 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; R36/37:Irritating to eyes and respiratory system.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
157373-08-5 2,3,4-trifluorobenzoyl chloride
service@apichina.com