| Product Name | 2,3,4-Trifluorobenzoic acid |
| CAS No. | 61079-72-9 |
| Synonyms | 2,3,4-3-Fluorobenzoic acid; RARECHEM AL BO 0257; TIMTEC-BB SBB006557; BUTTPARK 30\01-45; 2,3,4-trifluorobenzoic acid and derivatives; 2,3,4-TRIFLUOROBENZOIC ACID THE DERIVATIVES; 2,3,4-Trifluorobenzoic; 2,3,4-Trifluorobenzoic acid 98%; 2-bromo-2,3,3,3-tetrafluoropropanoyl fluoride; 2,3,4-trifluorobenzoate |
| InChI | InChI=1/C7H3F3O2/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2H,(H,11,12)/p-1 |
| Molecular Formula | C7H2F3O2 |
| Molecular Weight | 175.0853 |
| Melting point | 139-143℃ |
| Boiling point | 245.3°C at 760 mmHg |
| Flash point | 102.1°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:; |
| Safety | S26:; S37/39:; |
61079-72-9 2,3,4-trifluorobenzoic acid
service@apichina.com