| Product Name | 2,3,4-trifluorobenzamide |
| CAS No. | 207919-09-3 |
| Synonyms | Trifluorobenzamide1 |
| InChI | InChI=1/C7H4F3NO/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2H,(H2,11,12) |
| Molecular Formula | C7H4F3NO |
| Molecular Weight | 175.108 |
| Density | 1.45g/cm3 |
| Melting point | 127-129℃ |
| Boiling point | 166°C at 760 mmHg |
| Flash point | 54.2°C |
| Refractive index | 1.494 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
207919-09-3 2,3,4-trifluorobenzamide
service@apichina.com