| Product Name | 2,3,4-Trichloronitrobenzene |
| CAS No. | 17700-09-3 |
| Synonyms | 1-Nitro-2,3,4-trichlorobenzene; 2,3,4-trichloronitrobenzole; 1,2,3-trichloro-4-nitrobenzene |
| InChI | InChI=1/C6H2Cl3NO2/c7-3-1-2-4(10(11)12)6(9)5(3)8/h1-2H |
| Molecular Formula | C6H2Cl3NO2 |
| Molecular Weight | 226.4446 |
| Density | 1.651g/cm3 |
| Melting point | 55-56℃ |
| Boiling point | 296.2°C at 760 mmHg |
| Flash point | 133°C |
| Refractive index | 1.609 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R33:Danger of cummulative effects.; |
| Safety | S28:After contact with skin, wash immediately with plenty of ...; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
17700-09-3 2,3,4-trichloronitrobenzene
service@apichina.com