| Product Name | 2,3,4-Tribromothiophene |
| CAS No. | 3141-25-1 |
| InChI | InChI=1/C4HBr3S/c5-2-1-8-4(7)3(2)6/h1H |
| Molecular Formula | C4HBr3S |
| Molecular Weight | 320.8277 |
| Density | 2.516g/cm3 |
| Boiling point | 277.5°C at 760 mmHg |
| Flash point | 121.6°C |
| Refractive index | 1.671 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
3141-25-1 2,3,4-tribromothiophene
service@apichina.com