| Product Name | 2-(3,4-Dimethoxyphenylthio)acetic acid |
| CAS No. | 95735-63-0 |
| Synonyms | 2-[(3,4-dimethoxyphenyl)thio]acetic acid; [(3,4-dimethoxyphenyl)sulfanyl]acetic acid; [(3,4-dimethoxyphenyl)sulfanyl]acetate |
| InChI | InChI=1/C10H12O4S/c1-13-8-4-3-7(5-9(8)14-2)15-6-10(11)12/h3-5H,6H2,1-2H3,(H,11,12)/p-1 |
| Molecular Formula | C10H11O4S |
| Molecular Weight | 227.2575 |
| Melting point | 101-103℃ |
| Boiling point | 376.4°C at 760 mmHg |
| Flash point | 181.4°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
95735-63-0 2-(3,4-dimethoxyphenylthio)acetic acid
service@apichina.com