| Product Name | 2-(3,4-Dimethoxyphenyl)ethylisothiocyanate, (3,4-Dimethoxyphenethylisothiocyanate) |
| CAS No. | 21714-25-0 |
| Synonyms | 2-(3,4-Dimethoxyphenyl)ethyl isothiocyanate; 3,4-Dimethoxyphenethyl isothiocyanate; 4-(2-isothiocyanatoethyl)-1,2-dimethoxybenzene |
| InChI | InChI=1/C11H13NO2S/c1-13-10-4-3-9(5-6-12-8-15)7-11(10)14-2/h3-4,7H,5-6H2,1-2H3 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.2914 |
| Density | 1.08g/cm3 |
| Boiling point | 349.1°C at 760 mmHg |
| Flash point | 164.9°C |
| Refractive index | 1.529 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
21714-25-0 2-(3,4-dimethoxyphenyl)ethylisothiocyanate, (3,4-dimethoxyphenethylisothiocyanate)
service@apichina.com