| Product Name | 2,3,4,6-Tetrafluoropyridine |
| CAS No. | 3512-13-8 |
| InChI | InChI=1/C5HF4N/c6-2-1-3(7)10-5(9)4(2)8/h1H |
| Molecular Formula | C5HF4N |
| Molecular Weight | 151.0618 |
| Density | 1.518g/cm3 |
| Boiling point | 114.6°C at 760 mmHg |
| Flash point | 23.1°C |
| Refractive index | 1.403 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
3512-13-8 2,3,4,6-tetrafluoropyridine
service@apichina.com