| Product Name | 2,3,4,5-Tetrafluorobenzylchloride |
| CAS No. | 21622-18-4 |
| Synonyms | 2,3,4,6-Tetrafluorobenzyl chloride; 2-(chloromethyl)-1,3,4,5-tetrafluorobenzene |
| InChI | InChI=1/C7H3ClF4/c8-2-3-4(9)1-5(10)7(12)6(3)11/h1H,2H2 |
| Molecular Formula | C7H3ClF4 |
| Molecular Weight | 198.5453 |
| Density | 1.482g/cm3 |
| Boiling point | 164.1°C at 760 mmHg |
| Flash point | 57.5°C |
| Refractive index | 1.449 |
| Risk Codes | R34:Causes burns.; R37:Irritating to respiratory system.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
21622-18-4 2,3,4,5-tetrafluorobenzylchloride
service@apichina.com