| Product Name | 2,3,4,5-Tetrachlorophenyl isothiocyanate |
| CAS No. | 206761-88-8 |
| Synonyms | 1,2,3,4-tetrachloro-5-isothiocyanatobenzene |
| InChI | InChI=1/C7HCl4NS/c8-3-1-4(12-2-13)6(10)7(11)5(3)9/h1H |
| Molecular Formula | C7HCl4NS |
| Molecular Weight | 272.9665 |
| Density | 1.63g/cm3 |
| Boiling point | 373.5°C at 760 mmHg |
| Flash point | 179.7°C |
| Refractive index | 1.649 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
206761-88-8 2,3,4,5-tetrachlorophenyl isothiocyanate
service@apichina.com