| Product Name | 2,3,4,5,6-Pentafluorobenzeneboronic acid |
| CAS No. | 1582-24-7 |
| Synonyms | 2,3,4,5,6-Pentafluorophenylboronic acid; Pentafluorophenylboronic acid; (pentafluorophenyl)boronic acid |
| InChI | InChI=1/C6H2BF5O2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h13-14H |
| Molecular Formula | C6H2BF5O2 |
| Molecular Weight | 211.8819 |
| Density | 1.61g/cm3 |
| Boiling point | 244°C at 760 mmHg |
| Flash point | 101.4°C |
| Refractive index | 1.429 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1582-24-7 2,3,4,5,6-pentafluorobenzeneboronic acid
service@apichina.com