| Product Name | 2-(2-thienylmethylidene)hydrazine-1-carbothioamide |
| CAS No. | 5351-91-7 |
| Synonyms | Hydrazinecarbothioamide, 2-(2-thienylmethylene)- (9CI); 2-Formylthiophene thiosemicarbazone; 2-Thiophenealdehyde thiosemicarbazone; 2-Thiophenecarbaldehyde thiosemicarbazone; AI3-52012; Semicarbazide, 4-(thenylidene)-2-thio-; 2-Thiophenecarboxaldehyde, thiosemicarbazone; 2-(thiophen-2-ylmethylidene)hydrazinecarbothioamide; thiophene-2-carbaldehyde thiosemicarbazone |
| InChI | InChI=1/C6H7N3S2/c7-6(10)9-8-4-5-2-1-3-11-5/h1-4H,(H3,7,9,10)/b8-4+ |
| Molecular Formula | C6H7N3S2 |
| Molecular Weight | 185.2699 |
| Density | 1.42g/cm3 |
| Melting point | 187℃ |
| Boiling point | 329.5°C at 760 mmHg |
| Flash point | 153.1°C |
| Refractive index | 1.71 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
5351-91-7 2-(2-thienylmethylidene)hydrazine-1-carbothioamide
service@apichina.com